C13H15N5O5 — CID 57383263
2-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,5,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7,9-tetraen-6-one (PubChem CID 57383263) has the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,5,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7,9-tetraen-6-one.
| Compound Name | 2-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,5,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7,9-tetraen-6-one |
|---|---|
| PubChem CID | 57383263 |
| Molecular Formula | C13H15N5O5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,5,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7,9-tetraen-6-one |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1c1cc2[nH]c(=O)nc3c2n1NC=N3 |
| InChI | InChI=1S/C13H15N5O5/c1-13(22)9(20)7(3-19)23-10(13)6-2-5-8-11(17-12(21)16-5)14-4-15-18(6)8/h2,4,7,9-10,19-20,22H,3H2,1H3,(H2,14,15,16,17,21)/t7-,9-,10+,13-/m1/s1 |
| InChIKey | PUJQCQDJIPIUSM-SQFXPHBZSA-N |
| XLogP | -1.51 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |