C28H32F6N4O4 — CID 57383380
1-[(2S,5R)-2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 57383380) has the molecular formula C28H32F6N4O4 and a molecular weight of 602.58 g/mol. Its IUPAC name is 1-[(2S,5R)-2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[(2S,5R)-2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 57383380 |
| Molecular Formula | C28H32F6N4O4 |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 1-[(2S,5R)-2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | C[C@@H]1CN(C(=O)COC2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)[C@@H](C)CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H32F6N4O4/c1-17-15-37(18(2)14-36(17)22-8-3-19(4-9-22)27(29,30)31)26(39)16-42-23-10-5-20(6-11-23)35-21-7-12-25(38(40)41)24(13-21)28(32,33)34/h3-4,7-9,12-13,17-18,20,23,35H,5-6,10-11,14-16H2,1-2H3/t17-,18+,20?,23?/m1/s1 |
| InChIKey | ULDSXKWFCKMOMJ-FAYMDZGFSA-N |
| XLogP | 6.50 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|