C21H21N3O2S — CID 57383471
22-methyl-13,18-dioxa-7-thia-3,5-diazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(22),2(25),3,5,8,10,12(24),19(23),20-nonaen-4-amine (PubChem CID 57383471) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 22-methyl-13,18-dioxa-7-thia-3,5-diazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(22),2(25),3,5,8,10,12(24),19(23),20-nonaen-4-amine.
| Compound Name | 22-methyl-13,18-dioxa-7-thia-3,5-diazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(22),2(25),3,5,8,10,12(24),19(23),20-nonaen-4-amine |
|---|---|
| PubChem CID | 57383471 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 22-methyl-13,18-dioxa-7-thia-3,5-diazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(22),2(25),3,5,8,10,12(24),19(23),20-nonaen-4-amine |
| SMILES | Cc1ccc2cc1-c1cc(nc(N)n1)Sc1cccc(c1)OCCCCO2 |
| InChI | InChI=1S/C21H21N3O2S/c1-14-7-8-16-12-18(14)19-13-20(24-21(22)23-19)27-17-6-4-5-15(11-17)25-9-2-3-10-26-16/h4-8,11-13H,2-3,9-10H2,1H3,(H2,22,23,24) |
| InChIKey | ZRQBUFWZLIUDMG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |