C16H18FN2O8P — CID 57384078
2-[(2R,3S,4R,5R)-5-[5-(4-fluorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid (PubChem CID 57384078) has the molecular formula C16H18FN2O8P and a molecular weight of 416.30 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[5-(4-fluorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[5-(4-fluorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 57384078 |
| Molecular Formula | C16H18FN2O8P |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[5-(4-fluorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H]2O)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN2O8P/c17-9-3-1-8(2-4-9)10-7-19(16(23)18-14(10)22)15-13(21)12(20)11(27-15)5-6-28(24,25)26/h1-4,7,11-13,15,20-21H,5-6H2,(H,18,22,23)(H2,24,25,26)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | BJYSQYZVTPFKAR-RGCMKSIDSA-N |
| XLogP | -0.47 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|