About 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid
4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid (PubChem CID 57384167) has the molecular formula C26H32N2O8
and a molecular weight of 500.55 g/mol. Its IUPAC name is 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid.
Molecular Properties
| Compound Name | 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid |
| PubChem CID | 57384167 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid |
| SMILES | CC[C@@]1(c2cccc(OC(=O)Nc3ccc(C(=O)O)cc3)c2)CCCCN(C)C1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C23H28N2O4.C3H4O4/c1-3-23(13-4-5-14-25(2)16-23)18-7-6-8-20(15-18)29-22(28)24-19-11-9-17(10-12-19)21(26)27;4-2(5)1-3(6)7/h6-12,15H,3-5,13-14,16H2,1-2H3,(H,24,28)(H,26,27);1H2,(H,4,5)(H,6,7)/t23-;/m1./s1 |
| InChIKey | JBKCTGLNDKVLQY-GNAFDRTKSA-N |
| XLogP | 4.30 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid?
The IUPAC name of 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid (CID 57384167) is 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid.
What is the SMILES notation for 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid?
The canonical SMILES for 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid is CC[C@@]1(c2cccc(OC(=O)Nc3ccc(C(=O)O)cc3)c2)CCCCN(C)C1.O=C(O)CC(=O)O.
What is the InChIKey of 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid?
The InChIKey is JBKCTGLNDKVLQY-GNAFDRTKSA-N. The full InChI is InChI=1S/C23H28N2O4.C3H4O4/c1-3-23(13-4-5-14-25(2)16-23)18-7-6-8-20(15-18)29-22(28)24-19-11-9-17(10-12-19)21(26)27;4-2(5)1-3(6)7/h6-12,15H,3-5,13-14,16H2,1-2H3,(H,24,28)(H,26,27);1H2,(H,4,5)(H,6,7)/t23-;/m1./s1.
What are the key properties of 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid?
4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid has a molecular weight of 500.55 g/mol, XLogP of 4.30, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[(3S)-3-ethyl-1-methylazepan-3-yl]phenoxy]carbonylamino]benzoic acid;propanedioic acid is sourced from PubChem (CID 57384167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).