C23H22F10N2O5S — CID 57384272
(3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-1,1-dioxo-5-[[3-(trifluoromethoxy)phenyl]methylamino]thian-4-ol (PubChem CID 57384272) has the molecular formula C23H22F10N2O5S and a molecular weight of 628.49 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-1,1-dioxo-5-[[3-(trifluoromethoxy)phenyl]methylamino]thian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-1,1-dioxo-5-[[3-(trifluoromethoxy)phenyl]methylamino]thian-4-ol |
|---|---|
| PubChem CID | 57384272 |
| Molecular Formula | C23H22F10N2O5S |
| Molecular Weight | 628.49 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-1,1-dioxo-5-[[3-(trifluoromethoxy)phenyl]methylamino]thian-4-ol |
| SMILES | Nc1c(F)cc(C[C@@H]2CS(=O)(=O)C[C@H](NCc3cccc(OC(F)(F)F)c3)[C@H]2O)cc1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H22F10N2O5S/c24-15-6-12(7-17(18(15)34)39-20(21(25,26)27)22(28,29)30)4-13-9-41(37,38)10-16(19(13)36)35-8-11-2-1-3-14(5-11)40-23(31,32)33/h1-3,5-7,13,16,19-20,35-36H,4,8-10,34H2/t13-,16+,19+/m1/s1 |
| InChIKey | OCEZDSXYNMWVGV-AZOIQLNYSA-N |
| XLogP | 4.28 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|