C24H30F7N3O5S — CID 57384274
(3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1,1-dioxothian-4-ol (PubChem CID 57384274) has the molecular formula C24H30F7N3O5S and a molecular weight of 605.57 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 57384274 |
| Molecular Formula | C24H30F7N3O5S |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)Cc1cc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3cc(F)c(N)c(OC(C(F)(F)F)C(F)(F)F)c3)[C@@H]2O)no1 |
| InChI | InChI=1S/C24H30F7N3O5S/c1-22(2,3)8-15-7-14(34-39-15)9-33-17-11-40(36,37)10-13(20(17)35)4-12-5-16(25)19(32)18(6-12)38-21(23(26,27)28)24(29,30)31/h5-7,13,17,20-21,33,35H,4,8-11,32H2,1-3H3/t13-,17+,20+/m1/s1 |
| InChIKey | JMAIWRCWOGUIRQ-VOWSPCBNSA-N |
| XLogP | 3.96 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|