About US10231967, Example 106
US10231967, Example 106 (PubChem CID 57384351) has the molecular formula C26H26F2N4O2
and a molecular weight of 464.52 g/mol.
Molecular Properties
| Compound Name | US10231967, Example 106 |
| PubChem CID | 57384351 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | — |
| SMILES | COc1cc(C#N)cc(-c2ccc3c(c2)C2(N=C(C)C(N)=N2)C2(CCC(OC(F)F)CC2)C3)c1 |
| InChI | InChI=1S/C26H26F2N4O2/c1-15-23(30)32-26(31-15)22-12-17(19-9-16(14-29)10-21(11-19)33-2)3-4-18(22)13-25(26)7-5-20(6-8-25)34-24(27)28/h3-4,9-12,20,24H,5-8,13H2,1-2H3,(H2,30,32) |
| InChIKey | DZGFZIMDVXHKMA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US10231967, Example 106 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10231967, Example 106?
The IUPAC name of US10231967, Example 106 (CID 57384351) is not available.
What is the SMILES notation for US10231967, Example 106?
The canonical SMILES for US10231967, Example 106 is COc1cc(C#N)cc(-c2ccc3c(c2)C2(N=C(C)C(N)=N2)C2(CCC(OC(F)F)CC2)C3)c1.
What is the InChIKey of US10231967, Example 106?
The InChIKey is DZGFZIMDVXHKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26F2N4O2/c1-15-23(30)32-26(31-15)22-12-17(19-9-16(14-29)10-21(11-19)33-2)3-4-18(22)13-25(26)7-5-20(6-8-25)34-24(27)28/h3-4,9-12,20,24H,5-8,13H2,1-2H3,(H2,30,32).
What are the key properties of US10231967, Example 106?
US10231967, Example 106 has a molecular weight of 464.52 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US10231967, Example 106 is sourced from PubChem (CID 57384351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).