C26H24F6N8O3 — CID 57384357
1-(2,2,2-trifluoroethyl)-3-[3-[7-[1-[1-(3,3,3-trifluoro-2-hydroxypropanoyl)piperidin-4-yl]pyrazol-4-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]urea (PubChem CID 57384357) has the molecular formula C26H24F6N8O3 and a molecular weight of 610.52 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-[3-[7-[1-[1-(3,3,3-trifluoro-2-hydroxypropanoyl)piperidin-4-yl]pyrazol-4-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]urea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-[3-[7-[1-[1-(3,3,3-trifluoro-2-hydroxypropanoyl)piperidin-4-yl]pyrazol-4-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 57384357 |
| Molecular Formula | C26H24F6N8O3 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-[3-[7-[1-[1-(3,3,3-trifluoro-2-hydroxypropanoyl)piperidin-4-yl]pyrazol-4-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(-c4cnn(C5CCN(C(=O)C(O)C(F)(F)F)CC5)c4)cnn23)c1 |
| InChI | InChI=1S/C26H24F6N8O3/c27-25(28,29)14-34-24(43)37-18-3-1-2-15(8-18)20-12-33-21-9-16(10-36-40(20)21)17-11-35-39(13-17)19-4-6-38(7-5-19)23(42)22(41)26(30,31)32/h1-3,8-13,19,22,41H,4-7,14H2,(H2,34,37,43) |
| InChIKey | FXKUVSKLGLGGLV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 129.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |