C20H17F3N2O2S — CID 57384535
5-(4-methylsulfonylphenyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 57384535) has the molecular formula C20H17F3N2O2S and a molecular weight of 406.43 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 5-(4-methylsulfonylphenyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 57384535 |
| Molecular Formula | C20H17F3N2O2S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(S(C)(=O)=O)cc3)cnc2N)cc1C(F)(F)F |
| InChI | InChI=1S/C20H17F3N2O2S/c1-12-3-4-14(10-18(12)20(21,22)23)17-9-15(11-25-19(17)24)13-5-7-16(8-6-13)28(2,26)27/h3-11H,1-2H3,(H2,24,25) |
| InChIKey | FYHRHLBJDZJKLC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |