C24H27ClN4O7S — CID 57384592
3-[3-[[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 57384592) has the molecular formula C24H27ClN4O7S and a molecular weight of 551.02 g/mol. Its IUPAC name is 3-[3-[[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 57384592 |
| Molecular Formula | C24H27ClN4O7S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 3-[3-[[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]sulfonyl]-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC[C@@H](Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N3C[C@H]4NCCO[C@@H]4C3)c2O)c(=O)c1=O)c1ccc(C)o1 |
| InChI | InChI=1S/C24H27ClN4O7S/c1-3-14(17-7-4-12(2)36-17)27-19-20(23(32)22(19)31)28-15-6-5-13(25)24(21(15)30)37(33,34)29-10-16-18(11-29)35-9-8-26-16/h4-7,14,16,18,26-28,30H,3,8-11H2,1-2H3/t14-,16-,18-/m1/s1 |
| InChIKey | VFGHMOHWKZPNJO-QGPMSJSTSA-N |
| XLogP | 2.21 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|