C13H13ClO4 — CID 57384684
(2S,3R,3aR,6aR)-2-[(R)-chloro(phenyl)methyl]-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 57384684) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is (2S,3R,3aR,6aR)-2-[(R)-chloro(phenyl)methyl]-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2S,3R,3aR,6aR)-2-[(R)-chloro(phenyl)methyl]-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 57384684 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (2S,3R,3aR,6aR)-2-[(R)-chloro(phenyl)methyl]-3-hydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1C[C@H]2O[C@H]([C@H](Cl)c3ccccc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H13ClO4/c14-10(7-4-2-1-3-5-7)13-11(16)12-8(17-13)6-9(15)18-12/h1-5,8,10-13,16H,6H2/t8-,10-,11-,12+,13-/m1/s1 |
| InChIKey | GRESNSMXFFGBSM-ZGYLKHSLSA-N |
| XLogP | 1.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|