C20H18O4 — CID 57384686
(1R,2S,11S,12S,16R)-2-phenyl-10,13,17-trioxatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-trien-14-one (PubChem CID 57384686) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (1R,2S,11S,12S,16R)-2-phenyl-10,13,17-trioxatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-trien-14-one.
| Compound Name | (1R,2S,11S,12S,16R)-2-phenyl-10,13,17-trioxatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-trien-14-one |
|---|---|
| PubChem CID | 57384686 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (1R,2S,11S,12S,16R)-2-phenyl-10,13,17-trioxatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-trien-14-one |
| SMILES | O=C1C[C@H]2O[C@@H]3[C@@H](c4ccccc4)c4ccccc4CO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C20H18O4/c21-16-10-15-18(24-16)20-19(23-15)17(12-6-2-1-3-7-12)14-9-5-4-8-13(14)11-22-20/h1-9,15,17-20H,10-11H2/t15-,17+,18+,19-,20-/m1/s1 |
| InChIKey | QCAVTTYSHUKHBB-DABHTEOTSA-N |
| XLogP | 2.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |