About 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine
6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine (PubChem CID 57384874) has the molecular formula C19H18FN3O2
and a molecular weight of 339.37 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine.
Molecular Properties
| Compound Name | 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine |
| PubChem CID | 57384874 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine |
| SMILES | COc1ccc(F)cc1-c1ccc2c(c1)C1(CCO2)N=C(C)C(N)=N1 |
| InChI | InChI=1S/C19H18FN3O2/c1-11-18(21)23-19(22-11)7-8-25-17-5-3-12(9-15(17)19)14-10-13(20)4-6-16(14)24-2/h3-6,9-10H,7-8H2,1-2H3,(H2,21,23) |
| InChIKey | PVASJWZFVWATEB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine?
The IUPAC name of 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine (CID 57384874) is 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine.
What is the SMILES notation for 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine?
The canonical SMILES for 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine is COc1ccc(F)cc1-c1ccc2c(c1)C1(CCO2)N=C(C)C(N)=N1.
What is the InChIKey of 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine?
The InChIKey is PVASJWZFVWATEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O2/c1-11-18(21)23-19(22-11)7-8-25-17-5-3-12(9-15(17)19)14-10-13(20)4-6-16(14)24-2/h3-6,9-10H,7-8H2,1-2H3,(H2,21,23).
What are the key properties of 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine?
6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine has a molecular weight of 339.37 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-fluoro-2-methoxyphenyl)-5'-methylspiro[2,3-dihydrochromene-4,2'-imidazole]-4'-amine is sourced from PubChem (CID 57384874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).