C12H20O5 — CID 57385206
(1R,2S,6S,8S)-4,4,6,11,11-pentamethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 57385206) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1R,2S,6S,8S)-4,4,6,11,11-pentamethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,8S)-4,4,6,11,11-pentamethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 57385206 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1R,2S,6S,8S)-4,4,6,11,11-pentamethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(C)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H20O5/c1-10(2)13-6-7-8(15-10)9-12(5,14-7)17-11(3,4)16-9/h7-9H,6H2,1-5H3/t7-,8+,9-,12-/m0/s1 |
| InChIKey | RKSRNGYECBIRPZ-NHRVJRKFSA-N |
| XLogP | 1.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |