About CID 57385372
CID 57385372 (PubChem CID 57385372) has the molecular formula C23H25ClN4O
and a molecular weight of 408.93 g/mol.
Molecular Properties
| Compound Name | CID 57385372 |
| PubChem CID | 57385372 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cncc(Cl)c3)cc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C23H25ClN4O/c1-14-21(25)28-23(27-14)20-10-15(17-9-18(24)13-26-12-17)3-4-16(20)11-22(23)7-5-19(29-2)6-8-22/h3-4,9-10,12-13,19H,5-8,11H2,1-2H3,(H2,25,28) |
| InChIKey | XSPYGYYSPGDIRH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 57385372 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57385372?
The IUPAC name of CID 57385372 (CID 57385372) is not available.
What is the SMILES notation for CID 57385372?
The canonical SMILES for CID 57385372 is COC1CCC2(CC1)Cc1ccc(-c3cncc(Cl)c3)cc1C21N=C(C)C(N)=N1.
What is the InChIKey of CID 57385372?
The InChIKey is XSPYGYYSPGDIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClN4O/c1-14-21(25)28-23(27-14)20-10-15(17-9-18(24)13-26-12-17)3-4-16(20)11-22(23)7-5-19(29-2)6-8-22/h3-4,9-10,12-13,19H,5-8,11H2,1-2H3,(H2,25,28).
What are the key properties of CID 57385372?
CID 57385372 has a molecular weight of 408.93 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57385372 is sourced from PubChem (CID 57385372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).