About (2S)-2-amino-3,3-dimethyl(114C)butanamide
(2S)-2-amino-3,3-dimethyl(114C)butanamide (PubChem CID 57385453) has the molecular formula C6H14N2O
and a molecular weight of 132.18 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl(114C)butanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-3,3-dimethyl(114C)butanamide |
| PubChem CID | 57385453 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl(114C)butanamide |
| SMILES | CC(C)(C)[C@H](N)[14C](N)=O |
| InChI | InChI=1S/C6H14N2O/c1-6(2,3)4(7)5(8)9/h4H,7H2,1-3H3,(H2,8,9)/t4-/m1/s1/i5+2 |
| InChIKey | QCVCCWSPZIUXEA-GSFOUZOUSA-N |
| XLogP | -0.15 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-3,3-dimethyl(114C)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3,3-dimethyl(114C)butanamide?
The IUPAC name of (2S)-2-amino-3,3-dimethyl(114C)butanamide (CID 57385453) is (2S)-2-amino-3,3-dimethyl(114C)butanamide.
What is the SMILES notation for (2S)-2-amino-3,3-dimethyl(114C)butanamide?
The canonical SMILES for (2S)-2-amino-3,3-dimethyl(114C)butanamide is CC(C)(C)[C@H](N)[14C](N)=O.
What is the InChIKey of (2S)-2-amino-3,3-dimethyl(114C)butanamide?
The InChIKey is QCVCCWSPZIUXEA-GSFOUZOUSA-N. The full InChI is InChI=1S/C6H14N2O/c1-6(2,3)4(7)5(8)9/h4H,7H2,1-3H3,(H2,8,9)/t4-/m1/s1/i5+2.
What are the key properties of (2S)-2-amino-3,3-dimethyl(114C)butanamide?
(2S)-2-amino-3,3-dimethyl(114C)butanamide has a molecular weight of 132.18 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3,3-dimethyl(114C)butanamide is sourced from PubChem (CID 57385453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).