C21H43NO7Si — CID 57385687
tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-trihydroxypentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57385687) has the molecular formula C21H43NO7Si and a molecular weight of 449.66 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-trihydroxypentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-trihydroxypentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57385687 |
| Molecular Formula | C21H43NO7Si |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3-trihydroxypentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](O)[C@@H](O)[C@H](O)CCO[Si](C)(C)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C21H43NO7Si/c1-19(2,3)29-18(26)22-14(13-27-21(22,7)8)16(24)17(25)15(23)11-12-28-30(9,10)20(4,5)6/h14-17,23-25H,11-13H2,1-10H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | ZBWLGRXPIUQLTA-YVSFHVDLSA-N |
| XLogP | 2.85 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|