About N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide
N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide (PubChem CID 57385739) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide.
Molecular Properties
| Compound Name | N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide |
| PubChem CID | 57385739 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide |
| SMILES | O=C(CCCn1ccc(=O)[nH]c1=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c25-18(12-7-14-24-15-13-19(26)23-21(24)27)22-20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,13,15,20H,7,12,14H2,(H,22,25)(H,23,26,27) |
| InChIKey | OZGDJGXFEZAUFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide?
The IUPAC name of N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide (CID 57385739) is N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide.
What is the SMILES notation for N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide?
The canonical SMILES for N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide is O=C(CCCn1ccc(=O)[nH]c1=O)NC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide?
The InChIKey is OZGDJGXFEZAUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c25-18(12-7-14-24-15-13-19(26)23-21(24)27)22-20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,13,15,20H,7,12,14H2,(H,22,25)(H,23,26,27).
What are the key properties of N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide?
N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide has a molecular weight of 363.42 g/mol, XLogP of 2.22, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-4-(2,4-dioxopyrimidin-1-yl)butanamide is sourced from PubChem (CID 57385739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).