About US9918985, Example 20t Isomer 2
US9918985, Example 20t Isomer 2 (PubChem CID 57385877) has the molecular formula C22H31N3O2
and a molecular weight of 369.51 g/mol.
Molecular Properties
| Compound Name | US9918985, Example 20t Isomer 2 |
| PubChem CID | 57385877 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(OCC(C)C)cc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C22H31N3O2/c1-14(2)13-27-18-6-5-16-12-21(9-7-17(26-4)8-10-21)22(19(16)11-18)24-15(3)20(23)25-22/h5-6,11,14,17H,7-10,12-13H2,1-4H3,(H2,23,25) |
| InChIKey | BQDUISPSAOQZDJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze US9918985, Example 20t Isomer 2 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US9918985, Example 20t Isomer 2?
The IUPAC name of US9918985, Example 20t Isomer 2 (CID 57385877) is not available.
What is the SMILES notation for US9918985, Example 20t Isomer 2?
The canonical SMILES for US9918985, Example 20t Isomer 2 is COC1CCC2(CC1)Cc1ccc(OCC(C)C)cc1C21N=C(C)C(N)=N1.
What is the InChIKey of US9918985, Example 20t Isomer 2?
The InChIKey is BQDUISPSAOQZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O2/c1-14(2)13-27-18-6-5-16-12-21(9-7-17(26-4)8-10-21)22(19(16)11-18)24-15(3)20(23)25-22/h5-6,11,14,17H,7-10,12-13H2,1-4H3,(H2,23,25).
What are the key properties of US9918985, Example 20t Isomer 2?
US9918985, Example 20t Isomer 2 has a molecular weight of 369.51 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for US9918985, Example 20t Isomer 2 is sourced from PubChem (CID 57385877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).