C21H30O7 — CID 57386241
[(3aS,4S,6R,9R,10R,11aR)-6-hydroxy-9-methoxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 57386241) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(3aS,4S,6R,9R,10R,11aR)-6-hydroxy-9-methoxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aS,4S,6R,9R,10R,11aR)-6-hydroxy-9-methoxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 57386241 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(3aS,4S,6R,9R,10R,11aR)-6-hydroxy-9-methoxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@H](OC)CC(=O)[C@](C)(O)C[C@H](OC(=O)/C(C)=C\C)[C@@H]12 |
| InChI | InChI=1S/C21H30O7/c1-7-11(2)19(23)28-16-10-21(5,25)17(22)9-14(26-6)12(3)8-15-18(16)13(4)20(24)27-15/h7,12,14-16,18,25H,4,8-10H2,1-3,5-6H3/b11-7-/t12-,14-,15-,16+,18+,21-/m1/s1 |
| InChIKey | SRKXZENOIPHTOL-SGQSMADDSA-N |
| XLogP | 2.12 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|