C14H16N6S2 — CID 57386483
4-ethyl-3-[3-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 57386483) has the molecular formula C14H16N6S2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 4-ethyl-3-[3-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[3-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 57386483 |
| Molecular Formula | C14H16N6S2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-ethyl-3-[3-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(-c2cccc(-c3n[nH]c(=S)n3CC)c2)n[nH]c1=S |
| InChI | InChI=1S/C14H16N6S2/c1-3-19-11(15-17-13(19)21)9-6-5-7-10(8-9)12-16-18-14(22)20(12)4-2/h5-8H,3-4H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | OFOAYFIHLYSGGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|