C27H38N2O2 — CID 57386691
(2R,11S,12S,16S)-2,16-dimethyl-15-(5-propoxy-3-pyridinyl)-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one (PubChem CID 57386691) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is (2R,11S,12S,16S)-2,16-dimethyl-15-(5-propoxy-3-pyridinyl)-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one.
| Compound Name | (2R,11S,12S,16S)-2,16-dimethyl-15-(5-propoxy-3-pyridinyl)-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one |
|---|---|
| PubChem CID | 57386691 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (2R,11S,12S,16S)-2,16-dimethyl-15-(5-propoxy-3-pyridinyl)-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one |
| SMILES | CCCOc1cncc(C2=CC[C@H]3[C@@H]4CCN5C(=O)CCCC[C@]5(C)C4CC[C@]23C)c1 |
| InChI | InChI=1S/C27H38N2O2/c1-4-15-31-20-16-19(17-28-18-20)22-8-9-23-21-11-14-29-25(30)7-5-6-12-27(29,3)24(21)10-13-26(22,23)2/h8,16-18,21,23-24H,4-7,9-15H2,1-3H3/t21-,23-,24?,26+,27+/m0/s1 |
| InChIKey | HJTNWSNKRQYGLP-JIHFOSBVSA-N |
| XLogP | 5.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |