C24H34N2 — CID 57386694
(2R,11S,12S,16S)-2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene (PubChem CID 57386694) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (2R,11S,12S,16S)-2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene.
| Compound Name | (2R,11S,12S,16S)-2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene |
|---|---|
| PubChem CID | 57386694 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R,11S,12S,16S)-2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene |
| SMILES | C[C@]12CCC3[C@@H](CCN4CCCCC[C@]34C)[C@@H]1CC=C2c1cccnc1 |
| InChI | InChI=1S/C24H34N2/c1-23-13-10-22-19(11-16-26-15-5-3-4-12-24(22,26)2)21(23)9-8-20(23)18-7-6-14-25-17-18/h6-8,14,17,19,21-22H,3-5,9-13,15-16H2,1-2H3/t19-,21-,22?,23+,24+/m0/s1 |
| InChIKey | RLAKJCBHCLESRM-PVDHWCSWSA-N |
| XLogP | 5.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |