C17H22ClN3O5S — CID 57386787
3-chloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide (PubChem CID 57386787) has the molecular formula C17H22ClN3O5S and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-chloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57386787 |
| Molecular Formula | C17H22ClN3O5S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-chloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(CCCOCn1ccc(=O)[nH]c1=O)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClN3O5S/c1-17(2,20-27(24,25)14-6-3-5-13(18)11-14)8-4-10-26-12-21-9-7-15(22)19-16(21)23/h3,5-7,9,11,20H,4,8,10,12H2,1-2H3,(H,19,22,23) |
| InChIKey | NRVNGKKVTWREFC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|