C24H31F3N2O4S — CID 57386814
(3S,4S,5R)-3-[[4-amino-3-(trifluoromethoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 57386814) has the molecular formula C24H31F3N2O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-(trifluoromethoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-(trifluoromethoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 57386814 |
| Molecular Formula | C24H31F3N2O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-(trifluoromethoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3ccc(N)c(OC(F)(F)F)c3)[C@@H]2O)c1 |
| InChI | InChI=1S/C24H31F3N2O4S/c1-23(2,3)18-6-4-5-16(10-18)12-29-20-14-34(31,32)13-17(22(20)30)9-15-7-8-19(28)21(11-15)33-24(25,26)27/h4-8,10-11,17,20,22,29-30H,9,12-14,28H2,1-3H3/t17-,20+,22+/m1/s1 |
| InChIKey | WXCDYKNOGRLTKM-AGHHOFFYSA-N |
| XLogP | 3.57 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|