C22H33ClN2O2S — CID 57387027
(1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-5-isocyano-1-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 57387027) has the molecular formula C22H33ClN2O2S and a molecular weight of 425.04 g/mol. Its IUPAC name is (1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-5-isocyano-1-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | (1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-5-isocyano-1-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 57387027 |
| Molecular Formula | C22H33ClN2O2S |
| Molecular Weight | 425.04 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-5-isocyano-1-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | [C-]#[N+][C@@]1(C)CC[C@H]([C@@]2(C)CC[C@H](Cl)C(C)(C)O2)[C@H]2[C@@H](N=C=S)[C@](C)(O)CC[C@@H]21 |
| InChI | InChI=1S/C22H33ClN2O2S/c1-19(2)16(23)9-12-22(5,27-19)15-7-10-20(3,24-6)14-8-11-21(4,26)18(17(14)15)25-13-28/h14-18,26H,7-12H2,1-5H3/t14-,15-,16-,17-,18+,20-,21+,22+/m0/s1 |
| InChIKey | CIABNVZZHQIWMQ-QJUHQHJTSA-N |
| XLogP | 5.28 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|