About 1-phenyl-4H-chromeno[3,4-d]triazole
1-phenyl-4H-chromeno[3,4-d]triazole (PubChem CID 57387758) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-phenyl-4H-chromeno[3,4-d]triazole.
Molecular Properties
| Compound Name | 1-phenyl-4H-chromeno[3,4-d]triazole |
| PubChem CID | 57387758 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-phenyl-4H-chromeno[3,4-d]triazole |
| SMILES | c1ccc(-n2nnc3c2-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C15H11N3O/c1-2-6-11(7-3-1)18-15-12-8-4-5-9-14(12)19-10-13(15)16-17-18/h1-9H,10H2 |
| InChIKey | MCGJHJLLKTYYJJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-4H-chromeno[3,4-d]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4H-chromeno[3,4-d]triazole?
The IUPAC name of 1-phenyl-4H-chromeno[3,4-d]triazole (CID 57387758) is 1-phenyl-4H-chromeno[3,4-d]triazole.
What is the SMILES notation for 1-phenyl-4H-chromeno[3,4-d]triazole?
The canonical SMILES for 1-phenyl-4H-chromeno[3,4-d]triazole is c1ccc(-n2nnc3c2-c2ccccc2OC3)cc1.
What is the InChIKey of 1-phenyl-4H-chromeno[3,4-d]triazole?
The InChIKey is MCGJHJLLKTYYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c1-2-6-11(7-3-1)18-15-12-8-4-5-9-14(12)19-10-13(15)16-17-18/h1-9H,10H2.
What are the key properties of 1-phenyl-4H-chromeno[3,4-d]triazole?
1-phenyl-4H-chromeno[3,4-d]triazole has a molecular weight of 249.27 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4H-chromeno[3,4-d]triazole is sourced from PubChem (CID 57387758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).