C26H34F4N2O4S — CID 57387808
(3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3,3,3-trifluoropropoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 57387808) has the molecular formula C26H34F4N2O4S and a molecular weight of 546.63 g/mol. Its IUPAC name is (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3,3,3-trifluoropropoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3,3,3-trifluoropropoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 57387808 |
| Molecular Formula | C26H34F4N2O4S |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (3S,4S,5R)-3-[[4-amino-3-fluoro-5-(3,3,3-trifluoropropoxy)phenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3cc(F)c(N)c(OCCC(F)(F)F)c3)[C@@H]2O)c1 |
| InChI | InChI=1S/C26H34F4N2O4S/c1-25(2,3)19-6-4-5-16(10-19)13-32-21-15-37(34,35)14-18(24(21)33)9-17-11-20(27)23(31)22(12-17)36-8-7-26(28,29)30/h4-6,10-12,18,21,24,32-33H,7-9,13-15,31H2,1-3H3/t18-,21+,24+/m1/s1 |
| InChIKey | HCNAIANLPZIMKT-ZHRMCQFGSA-N |
| XLogP | 4.14 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|