C23H25N5O3 — CID 57387873
N-[1-(cyclopropylmethyl)-3-methylindazol-4-yl]-7-(2-methoxyethoxy)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 57387873) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[1-(cyclopropylmethyl)-3-methylindazol-4-yl]-7-(2-methoxyethoxy)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[1-(cyclopropylmethyl)-3-methylindazol-4-yl]-7-(2-methoxyethoxy)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57387873 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[1-(cyclopropylmethyl)-3-methylindazol-4-yl]-7-(2-methoxyethoxy)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COCCOc1ccn2c(C(=O)Nc3cccc4c3c(C)nn4CC3CC3)cnc2c1 |
| InChI | InChI=1S/C23H25N5O3/c1-15-22-18(4-3-5-19(22)28(26-15)14-16-6-7-16)25-23(29)20-13-24-21-12-17(8-9-27(20)21)31-11-10-30-2/h3-5,8-9,12-13,16H,6-7,10-11,14H2,1-2H3,(H,25,29) |
| InChIKey | LICJBYVQMNQFMP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|