C24H18O2 — CID 57387958
(1S,16R)-hexacyclo[14.6.2.02,15.04,13.06,11.017,22]tetracosa-2,4,6,8,10,12,14,17,19,21-decaene-23,24-diol (PubChem CID 57387958) has the molecular formula C24H18O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (1S,16R)-hexacyclo[14.6.2.02,15.04,13.06,11.017,22]tetracosa-2,4,6,8,10,12,14,17,19,21-decaene-23,24-diol.
| Compound Name | (1S,16R)-hexacyclo[14.6.2.02,15.04,13.06,11.017,22]tetracosa-2,4,6,8,10,12,14,17,19,21-decaene-23,24-diol |
|---|---|
| PubChem CID | 57387958 |
| Molecular Formula | C24H18O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (1S,16R)-hexacyclo[14.6.2.02,15.04,13.06,11.017,22]tetracosa-2,4,6,8,10,12,14,17,19,21-decaene-23,24-diol |
| SMILES | OC1C(O)[C@H]2c3ccccc3[C@@H]1c1cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C24H18O2/c25-23-21-17-7-3-4-8-18(17)22(24(23)26)20-12-16-10-14-6-2-1-5-13(14)9-15(16)11-19(20)21/h1-12,21-26H/t21-,22+,23?,24? |
| InChIKey | RCMVQSHZJGBYJF-KFGJODCASA-N |
| XLogP | 4.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|