C22H23NO6 — CID 57388140
ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-phenylpropanoate (PubChem CID 57388140) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-phenylpropanoate.
| Compound Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 57388140 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C22H23NO6/c1-2-29-22(28)18(10-14-6-4-3-5-7-14)23-20(26)12-16(21(23)27)11-15-8-9-17(24)13-19(15)25/h3-9,13,16,18,24-25H,2,10-12H2,1H3 |
| InChIKey | CHIRDLITNXSEBG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|