C22H23NO7 — CID 57388141
ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-(4-hydroxyphenyl)propanoate (PubChem CID 57388141) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 57388141 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C22H23NO7/c1-2-30-22(29)18(9-13-3-6-16(24)7-4-13)23-20(27)11-15(21(23)28)10-14-5-8-17(25)12-19(14)26/h3-8,12,15,18,24-26H,2,9-11H2,1H3 |
| InChIKey | LYDWARDQGOQUMG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|