C16H19NO6S — CID 57388143
ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoate (PubChem CID 57388143) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoate.
| Compound Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 57388143 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)C(CS)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C16H19NO6S/c1-2-23-16(22)12(8-24)17-14(20)6-10(15(17)21)5-9-3-4-11(18)7-13(9)19/h3-4,7,10,12,18-19,24H,2,5-6,8H2,1H3 |
| InChIKey | PDQBHJOCCVXLON-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|