C18H23NO6S — CID 57388144
ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-methylsulfanylbutanoate (PubChem CID 57388144) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-methylsulfanylbutanoate.
| Compound Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 57388144 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | ethyl 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CCSC)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C18H23NO6S/c1-3-25-18(24)14(6-7-26-2)19-16(22)9-12(17(19)23)8-11-4-5-13(20)10-15(11)21/h4-5,10,12,14,20-21H,3,6-9H2,1-2H3 |
| InChIKey | SYYCEWHWSXQPFX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|