C15H18N2O5 — CID 57388146
4-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]butanamide (PubChem CID 57388146) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]butanamide.
| Compound Name | 4-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 57388146 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]butanamide |
| SMILES | NC(=O)CCCN1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C15H18N2O5/c16-13(20)2-1-5-17-14(21)7-10(15(17)22)6-9-3-4-11(18)8-12(9)19/h3-4,8,10,18-19H,1-2,5-7H2,(H2,16,20) |
| InChIKey | ZDZWGRIIOSBZCT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|