C14H16N2O6 — CID 57388176
2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-hydroxypropanamide (PubChem CID 57388176) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-hydroxypropanamide.
| Compound Name | 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 57388176 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-3-hydroxypropanamide |
| SMILES | NC(=O)C(CO)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C14H16N2O6/c15-13(21)10(6-17)16-12(20)4-8(14(16)22)3-7-1-2-9(18)5-11(7)19/h1-2,5,8,10,17-19H,3-4,6H2,(H2,15,21) |
| InChIKey | MLGKMJAIWIHJHR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|