C17H20N2O7 — CID 57388177
ethyl 4-amino-2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-oxobutanoate (PubChem CID 57388177) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is ethyl 4-amino-2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-amino-2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 57388177 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 4-amino-2-[3-[(2,4-dihydroxyphenyl)methyl]-2,5-dioxopyrrolidin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)C(CC(N)=O)N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C17H20N2O7/c1-2-26-17(25)12(8-14(18)22)19-15(23)6-10(16(19)24)5-9-3-4-11(20)7-13(9)21/h3-4,7,10,12,20-21H,2,5-6,8H2,1H3,(H2,18,22) |
| InChIKey | WVVFSOAQCMUTDQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|