About 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione
3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione (PubChem CID 57388180) has the molecular formula C16H19NO5
and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione |
| PubChem CID | 57388180 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cc2ccc(O)cc2O)C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C16H19NO5/c18-12-4-3-10(14(19)8-12)6-11-7-15(20)17(16(11)21)9-13-2-1-5-22-13/h3-4,8,11,13,18-19H,1-2,5-7,9H2 |
| InChIKey | RLLSGXLVSBQMJS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione?
The IUPAC name of 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione (CID 57388180) is 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione.
What is the SMILES notation for 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione?
The canonical SMILES for 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione is O=C1CC(Cc2ccc(O)cc2O)C(=O)N1CC1CCCO1.
What is the InChIKey of 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione?
The InChIKey is RLLSGXLVSBQMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5/c18-12-4-3-10(14(19)8-12)6-11-7-15(20)17(16(11)21)9-13-2-1-5-22-13/h3-4,8,11,13,18-19H,1-2,5-7,9H2.
What are the key properties of 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione?
3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione has a molecular weight of 305.33 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dihydroxyphenyl)methyl]-1-(oxolan-2-ylmethyl)pyrrolidine-2,5-dione is sourced from PubChem (CID 57388180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).