About 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione
1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 57388213) has the molecular formula C11H12N2O4
and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione |
| PubChem CID | 57388213 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | NN1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C11H12N2O4/c12-13-10(16)4-7(11(13)17)3-6-1-2-8(14)5-9(6)15/h1-2,5,7,14-15H,3-4,12H2 |
| InChIKey | PJOZNOIYAVHMLO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione?
The IUPAC name of 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione (CID 57388213) is 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione?
The canonical SMILES for 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione is NN1C(=O)CC(Cc2ccc(O)cc2O)C1=O.
What is the InChIKey of 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione?
The InChIKey is PJOZNOIYAVHMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c12-13-10(16)4-7(11(13)17)3-6-1-2-8(14)5-9(6)15/h1-2,5,7,14-15H,3-4,12H2.
What are the key properties of 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione?
1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione has a molecular weight of 236.23 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[(2,4-dihydroxyphenyl)methyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 57388213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).