C30H38F3N7O2 — CID 57388496
(1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol (PubChem CID 57388496) has the molecular formula C30H38F3N7O2 and a molecular weight of 585.68 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 57388496 |
| Molecular Formula | C30H38F3N7O2 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
| SMILES | CC(C)N(CCCCc1nc2ccc(C(F)(F)F)cc2[nH]1)C[C@H]1C[C@@H](n2ccc3c(NC4CC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H38F3N7O2/c1-17(2)39(11-4-3-5-25-37-22-9-6-19(30(31,32)33)14-23(22)38-25)15-18-13-24(27(42)26(18)41)40-12-10-21-28(36-20-7-8-20)34-16-35-29(21)40/h6,9-10,12,14,16-18,20,24,26-27,41-42H,3-5,7-8,11,13,15H2,1-2H3,(H,37,38)(H,34,35,36)/t18-,24-,26-,27+/m1/s1 |
| InChIKey | APFXYZGYPOAORW-YLMCOQJISA-N |
| XLogP | 4.92 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|