C28H34F3N7O2 — CID 57388497
(1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol (PubChem CID 57388497) has the molecular formula C28H34F3N7O2 and a molecular weight of 557.62 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 57388497 |
| Molecular Formula | C28H34F3N7O2 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | (1R,2S,3R,5R)-3-[4-(cyclopropylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[methyl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
| SMILES | CN(CCCCc1nc2ccc(C(F)(F)F)cc2[nH]1)C[C@H]1C[C@@H](n2ccc3c(NC4CC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H34F3N7O2/c1-37(10-3-2-4-23-35-20-8-5-17(28(29,30)31)13-21(20)36-23)14-16-12-22(25(40)24(16)39)38-11-9-19-26(34-18-6-7-18)32-15-33-27(19)38/h5,8-9,11,13,15-16,18,22,24-25,39-40H,2-4,6-7,10,12,14H2,1H3,(H,35,36)(H,32,33,34)/t16-,22-,24-,25+/m1/s1 |
| InChIKey | NXTNUYGGXWDCCU-MJKPMQHNSA-N |
| XLogP | 4.14 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|