About tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate
tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate (PubChem CID 57389111) has the molecular formula C24H23ClN2O3
and a molecular weight of 422.91 g/mol. Its IUPAC name is tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate |
| PubChem CID | 57389111 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate |
| SMILES | Cc1noc2c1-c1ccccc1C(c1ccc(Cl)cc1)=N[C@@H]2CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H23ClN2O3/c1-14-21-17-7-5-6-8-18(17)22(15-9-11-16(25)12-10-15)26-19(23(21)30-27-14)13-20(28)29-24(2,3)4/h5-12,19H,13H2,1-4H3/t19-/m1/s1 |
| InChIKey | BYWUOGUODWGCKU-LJQANCHMSA-N |
| XLogP | 5.93 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate?
The IUPAC name of tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate (CID 57389111) is tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate.
What is the SMILES notation for tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate?
The canonical SMILES for tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate is Cc1noc2c1-c1ccccc1C(c1ccc(Cl)cc1)=N[C@@H]2CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate?
The InChIKey is BYWUOGUODWGCKU-LJQANCHMSA-N. The full InChI is InChI=1S/C24H23ClN2O3/c1-14-21-17-7-5-6-8-18(17)22(15-9-11-16(25)12-10-15)26-19(23(21)30-27-14)13-20(28)29-24(2,3)4/h5-12,19H,13H2,1-4H3/t19-/m1/s1.
What are the key properties of tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate?
tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate has a molecular weight of 422.91 g/mol, XLogP of 5.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetate is sourced from PubChem (CID 57389111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).