About 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile
4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile (PubChem CID 57389155) has the molecular formula C17H14N4O
and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile |
| PubChem CID | 57389155 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc3c(n2)CC2(CC2)CC3=O)cc1 |
| InChI | InChI=1S/C17H14N4O/c18-9-11-1-3-12(4-2-11)20-16-19-10-13-14(21-16)7-17(5-6-17)8-15(13)22/h1-4,10H,5-8H2,(H,19,20,21) |
| InChIKey | WKAKPDVTMIKODP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile?
The IUPAC name of 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile (CID 57389155) is 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile.
What is the SMILES notation for 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile?
The canonical SMILES for 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile is N#Cc1ccc(Nc2ncc3c(n2)CC2(CC2)CC3=O)cc1.
What is the InChIKey of 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile?
The InChIKey is WKAKPDVTMIKODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O/c18-9-11-1-3-12(4-2-11)20-16-19-10-13-14(21-16)7-17(5-6-17)8-15(13)22/h1-4,10H,5-8H2,(H,19,20,21).
What are the key properties of 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile?
4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile has a molecular weight of 290.33 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-oxospiro[6,8-dihydroquinazoline-7,1'-cyclopropane]-2-yl)amino]benzonitrile is sourced from PubChem (CID 57389155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).