C7H7F3N6O3S — CID 57389182
N-methyl-4-oxo-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-sulfonamide (PubChem CID 57389182) has the molecular formula C7H7F3N6O3S and a molecular weight of 312.23 g/mol. Its IUPAC name is N-methyl-4-oxo-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-sulfonamide.
| Compound Name | N-methyl-4-oxo-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-sulfonamide |
|---|---|
| PubChem CID | 57389182 |
| Molecular Formula | C7H7F3N6O3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | N-methyl-4-oxo-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-sulfonamide |
| SMILES | CNS(=O)(=O)c1ncn2c(=O)n(CC(F)(F)F)nnc12 |
| InChI | InChI=1S/C7H7F3N6O3S/c1-11-20(18,19)5-4-13-14-16(2-7(8,9)10)6(17)15(4)3-12-5/h3,11H,2H2,1H3 |
| InChIKey | ABEZJBSBVKXBLC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |