C24H28FN5O5 — CID 57389216
N-[9-fluoro-4-[(3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-1-yl]-N',N'-dimethyloxamide (PubChem CID 57389216) has the molecular formula C24H28FN5O5 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[9-fluoro-4-[(3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-1-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[9-fluoro-4-[(3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-1-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 57389216 |
| Molecular Formula | C24H28FN5O5 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[9-fluoro-4-[(3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-1-yl]-N',N'-dimethyloxamide |
| SMILES | Cc1cccc(CNC(=O)C2N=C3N(CC4(F)CCC3(NC(=O)C(=O)N(C)C)CC4)C(=O)C2=O)c1 |
| InChI | InChI=1S/C24H28FN5O5/c1-14-5-4-6-15(11-14)12-26-18(32)16-17(31)20(34)30-13-23(25)7-9-24(10-8-23,22(30)27-16)28-19(33)21(35)29(2)3/h4-6,11,16H,7-10,12-13H2,1-3H3,(H,26,32)(H,28,33) |
| InChIKey | LXRSHWGGTLHNER-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|