About 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide
1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 57389397) has the molecular formula C14H15N5O
and a molecular weight of 269.31 g/mol. Its IUPAC name is 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide.
Molecular Properties
| Compound Name | 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide |
| PubChem CID | 57389397 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | CC(C)(C)n1nc(C(N)=O)c2ccc3cncnc3c21 |
| InChI | InChI=1S/C14H15N5O/c1-14(2,3)19-12-9(11(18-19)13(15)20)5-4-8-6-16-7-17-10(8)12/h4-7H,1-3H3,(H2,15,20) |
| InChIKey | XDERQDSXXASZLS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide?
The IUPAC name of 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide (CID 57389397) is 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide.
What is the SMILES notation for 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide?
The canonical SMILES for 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide is CC(C)(C)n1nc(C(N)=O)c2ccc3cncnc3c21.
What is the InChIKey of 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide?
The InChIKey is XDERQDSXXASZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O/c1-14(2,3)19-12-9(11(18-19)13(15)20)5-4-8-6-16-7-17-10(8)12/h4-7H,1-3H3,(H2,15,20).
What are the key properties of 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide?
1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide has a molecular weight of 269.31 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpyrazolo[4,5-h]quinazoline-3-carboxamide is sourced from PubChem (CID 57389397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).