C32H36FN5O8S — CID 57389699
[1-[[2-(dimethylamino)-2-oxoacetyl]amino]-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-9-yl]methyl 4-methylbenzenesulfonate (PubChem CID 57389699) has the molecular formula C32H36FN5O8S and a molecular weight of 669.73 g/mol. Its IUPAC name is [1-[[2-(dimethylamino)-2-oxoacetyl]amino]-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-9-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[[2-(dimethylamino)-2-oxoacetyl]amino]-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-9-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57389699 |
| Molecular Formula | C32H36FN5O8S |
| Molecular Weight | 669.73 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | [1-[[2-(dimethylamino)-2-oxoacetyl]amino]-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5,6-dioxo-3,7-diazatricyclo[7.2.2.02,7]tridec-2-en-9-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC23CCC(NC(=O)C(=O)N(C)C)(CC2)C2=NC(C(=O)NCc4ccc(F)c(C)c4)C(=O)C(=O)N2C3)cc1 |
| InChI | InChI=1S/C32H36FN5O8S/c1-19-5-8-22(9-6-19)47(44,45)46-18-31-11-13-32(14-12-31,36-27(41)29(43)37(3)4)30-35-24(25(39)28(42)38(30)17-31)26(40)34-16-21-7-10-23(33)20(2)15-21/h5-10,15,24H,11-14,16-18H2,1-4H3,(H,34,40)(H,36,41) |
| InChIKey | XVDVUBSXJXDJEW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 171.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.73 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|