C21H38B2O6 — CID 573900
2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-undec-10-enoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole (PubChem CID 573900) has the molecular formula C21H38B2O6 and a molecular weight of 408.15 g/mol. Its IUPAC name is 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-undec-10-enoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole.
| Compound Name | 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-undec-10-enoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 573900 |
| Molecular Formula | C21H38B2O6 |
| Molecular Weight | 408.15 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 2-ethyl-6-(2-ethyl-1,3,2-dioxaborolan-4-yl)-4-undec-10-enoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborole |
| SMILES | C=CCCCCCCCCCOC1OC(C2COB(CC)O2)C2OB(CC)OC12 |
| InChI | InChI=1S/C21H38B2O6/c1-4-7-8-9-10-11-12-13-14-15-24-21-20-19(28-23(6-3)29-20)18(26-21)17-16-25-22(5-2)27-17/h4,17-21H,1,5-16H2,2-3H3 |
| InChIKey | HQKYACHMHSNRCC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|