C13H12N2O5 — CID 57390149
5-ethyl-2-(4-hydroxybut-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 57390149) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-ethyl-2-(4-hydroxybut-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-(4-hydroxybut-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 57390149 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-ethyl-2-(4-hydroxybut-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(OCC#CCO)[nH]c(=O)c12 |
| InChI | InChI=1S/C13H12N2O5/c1-2-8-7-9(17)20-12-10(8)11(18)14-13(15-12)19-6-4-3-5-16/h7,16H,2,5-6H2,1H3,(H,14,15,18) |
| InChIKey | OGQGQUPVSBZSNY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|